C32H32O8 — CID 19886882
(4-butoxycarbonyloxy-2,3-diphenoxynaphthalen-1-yl) butyl carbonate (PubChem CID 19886882) has the molecular formula C32H32O8 and a molecular weight of 544.60 g/mol. Its IUPAC name is (4-butoxycarbonyloxy-2,3-diphenoxynaphthalen-1-yl) butyl carbonate.
| Compound Name | (4-butoxycarbonyloxy-2,3-diphenoxynaphthalen-1-yl) butyl carbonate |
|---|---|
| PubChem CID | 19886882 |
| Molecular Formula | C32H32O8 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | (4-butoxycarbonyloxy-2,3-diphenoxynaphthalen-1-yl) butyl carbonate |
| SMILES | CCCCOC(=O)Oc1c(Oc2ccccc2)c(Oc2ccccc2)c(OC(=O)OCCCC)c2ccccc12 |
| InChI | InChI=1S/C32H32O8/c1-3-5-21-35-31(33)39-27-25-19-13-14-20-26(25)28(40-32(34)36-22-6-4-2)30(38-24-17-11-8-12-18-24)29(27)37-23-15-9-7-10-16-23/h7-20H,3-6,21-22H2,1-2H3 |
| InChIKey | NIGYBRDIOYITLM-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|