C32H25ClO7 — CID 54510563
[7-chloro-4-hydroxy-2,3-bis(4-methoxyphenoxy)naphthalen-1-yl] 2-phenylacetate (PubChem CID 54510563) has the molecular formula C32H25ClO7 and a molecular weight of 557.00 g/mol. Its IUPAC name is [7-chloro-4-hydroxy-2,3-bis(4-methoxyphenoxy)naphthalen-1-yl] 2-phenylacetate.
| Compound Name | [7-chloro-4-hydroxy-2,3-bis(4-methoxyphenoxy)naphthalen-1-yl] 2-phenylacetate |
|---|---|
| PubChem CID | 54510563 |
| Molecular Formula | C32H25ClO7 |
| Molecular Weight | 557.00 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | [7-chloro-4-hydroxy-2,3-bis(4-methoxyphenoxy)naphthalen-1-yl] 2-phenylacetate |
| SMILES | COc1ccc(Oc2c(Oc3ccc(OC)cc3)c(OC(=O)Cc3ccccc3)c3cc(Cl)ccc3c2O)cc1 |
| InChI | InChI=1S/C32H25ClO7/c1-36-22-9-13-24(14-10-22)38-31-29(35)26-17-8-21(33)19-27(26)30(40-28(34)18-20-6-4-3-5-7-20)32(31)39-25-15-11-23(37-2)12-16-25/h3-17,19,35H,18H2,1-2H3 |
| InChIKey | YIUQUTIAKUQVQU-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.00 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|