About (6-chloro-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) 2-methylpropanoate
(6-chloro-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) 2-methylpropanoate (PubChem CID 54510847) has the molecular formula C16H17ClO5
and a molecular weight of 324.76 g/mol. Its IUPAC name is (6-chloro-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) 2-methylpropanoate.
Molecular Properties
| Compound Name | (6-chloro-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) 2-methylpropanoate |
| PubChem CID | 54510847 |
| Molecular Formula | C16H17ClO5 |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | (6-chloro-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) 2-methylpropanoate |
| SMILES | COc1c(OC)c(OC(=O)C(C)C)c2ccc(Cl)cc2c1O |
| InChI | InChI=1S/C16H17ClO5/c1-8(2)16(19)22-13-10-6-5-9(17)7-11(10)12(18)14(20-3)15(13)21-4/h5-8,18H,1-4H3 |
| InChIKey | YIZWZOZWCMVJJX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (6-chloro-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) 2-methylpropanoate?
The IUPAC name of (6-chloro-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) 2-methylpropanoate (CID 54510847) is (6-chloro-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) 2-methylpropanoate.
What is the SMILES notation for (6-chloro-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) 2-methylpropanoate?
The canonical SMILES for (6-chloro-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) 2-methylpropanoate is COc1c(OC)c(OC(=O)C(C)C)c2ccc(Cl)cc2c1O.
What is the InChIKey of (6-chloro-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) 2-methylpropanoate?
The InChIKey is YIZWZOZWCMVJJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClO5/c1-8(2)16(19)22-13-10-6-5-9(17)7-11(10)12(18)14(20-3)15(13)21-4/h5-8,18H,1-4H3.
What are the key properties of (6-chloro-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) 2-methylpropanoate?
(6-chloro-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) 2-methylpropanoate has a molecular weight of 324.76 g/mol, XLogP of 3.78, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-4-hydroxy-2,3-dimethoxynaphthalen-1-yl) 2-methylpropanoate is sourced from PubChem (CID 54510847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).