C33H41ClO6 — CID 23038376
(7-chloro-4-octanoyloxy-2,3-dipropoxynaphthalen-1-yl) 4-ethylbenzoate (PubChem CID 23038376) has the molecular formula C33H41ClO6 and a molecular weight of 569.14 g/mol. Its IUPAC name is (7-chloro-4-octanoyloxy-2,3-dipropoxynaphthalen-1-yl) 4-ethylbenzoate.
| Compound Name | (7-chloro-4-octanoyloxy-2,3-dipropoxynaphthalen-1-yl) 4-ethylbenzoate |
|---|---|
| PubChem CID | 23038376 |
| Molecular Formula | C33H41ClO6 |
| Molecular Weight | 569.14 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | (7-chloro-4-octanoyloxy-2,3-dipropoxynaphthalen-1-yl) 4-ethylbenzoate |
| SMILES | CCCCCCCC(=O)Oc1c(OCCC)c(OCCC)c(OC(=O)c2ccc(CC)cc2)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C33H41ClO6/c1-5-9-10-11-12-13-28(35)39-29-26-19-18-25(34)22-27(26)30(32(38-21-7-3)31(29)37-20-6-2)40-33(36)24-16-14-23(8-4)15-17-24/h14-19,22H,5-13,20-21H2,1-4H3 |
| InChIKey | IWIJVJQTDRRHPF-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.14 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|