C27H30ClFO6 — CID 149158570
(4-butanoyloxy-7-chloro-2,3-dipropoxynaphthalen-1-yl) 1-fluorocyclohexa-2,4-diene-1-carboxylate (PubChem CID 149158570) has the molecular formula C27H30ClFO6 and a molecular weight of 504.98 g/mol. Its IUPAC name is (4-butanoyloxy-7-chloro-2,3-dipropoxynaphthalen-1-yl) 1-fluorocyclohexa-2,4-diene-1-carboxylate.
| Compound Name | (4-butanoyloxy-7-chloro-2,3-dipropoxynaphthalen-1-yl) 1-fluorocyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 149158570 |
| Molecular Formula | C27H30ClFO6 |
| Molecular Weight | 504.98 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | (4-butanoyloxy-7-chloro-2,3-dipropoxynaphthalen-1-yl) 1-fluorocyclohexa-2,4-diene-1-carboxylate |
| SMILES | CCCOc1c(OCCC)c(OC(=O)C2(F)C=CC=CC2)c2cc(Cl)ccc2c1OC(=O)CCC |
| InChI | InChI=1S/C27H30ClFO6/c1-4-10-21(30)34-22-19-12-11-18(28)17-20(19)23(25(33-16-6-3)24(22)32-15-5-2)35-26(31)27(29)13-8-7-9-14-27/h7-9,11-13,17H,4-6,10,14-16H2,1-3H3 |
| InChIKey | XHYQMONHEYXCMZ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.98 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|