C27H32O5 — CID 57193117
(6-benzyl-2,3-dimethoxy-4-pentoxynaphthalen-1-yl) propanoate (PubChem CID 57193117) has the molecular formula C27H32O5 and a molecular weight of 436.55 g/mol. Its IUPAC name is (6-benzyl-2,3-dimethoxy-4-pentoxynaphthalen-1-yl) propanoate.
| Compound Name | (6-benzyl-2,3-dimethoxy-4-pentoxynaphthalen-1-yl) propanoate |
|---|---|
| PubChem CID | 57193117 |
| Molecular Formula | C27H32O5 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | (6-benzyl-2,3-dimethoxy-4-pentoxynaphthalen-1-yl) propanoate |
| SMILES | CCCCCOc1c(OC)c(OC)c(OC(=O)CC)c2ccc(Cc3ccccc3)cc12 |
| InChI | InChI=1S/C27H32O5/c1-5-7-11-16-31-24-22-18-20(17-19-12-9-8-10-13-19)14-15-21(22)25(32-23(28)6-2)27(30-4)26(24)29-3/h8-10,12-15,18H,5-7,11,16-17H2,1-4H3 |
| InChIKey | BPNIMLFUCHQHFG-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|