C27H37ClO6 — CID 23038602
(8-chloro-2,3-dipentoxy-4-propanoyloxynaphthalen-1-yl) butanoate (PubChem CID 23038602) has the molecular formula C27H37ClO6 and a molecular weight of 493.04 g/mol. Its IUPAC name is (8-chloro-2,3-dipentoxy-4-propanoyloxynaphthalen-1-yl) butanoate.
| Compound Name | (8-chloro-2,3-dipentoxy-4-propanoyloxynaphthalen-1-yl) butanoate |
|---|---|
| PubChem CID | 23038602 |
| Molecular Formula | C27H37ClO6 |
| Molecular Weight | 493.04 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | (8-chloro-2,3-dipentoxy-4-propanoyloxynaphthalen-1-yl) butanoate |
| SMILES | CCCCCOc1c(OCCCCC)c(OC(=O)CCC)c2c(Cl)cccc2c1OC(=O)CC |
| InChI | InChI=1S/C27H37ClO6/c1-5-9-11-17-31-26-24(33-21(29)8-4)19-15-13-16-20(28)23(19)25(34-22(30)14-7-3)27(26)32-18-12-10-6-2/h13,15-16H,5-12,14,17-18H2,1-4H3 |
| InChIKey | HMAHUQCPEJGJBC-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.04 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|