C19H18Cl2O — CID 87876071
1,8-dichloro-9-pentoxyanthracene (PubChem CID 87876071) has the molecular formula C19H18Cl2O and a molecular weight of 333.26 g/mol. Its IUPAC name is 1,8-dichloro-9-pentoxyanthracene.
| Compound Name | 1,8-dichloro-9-pentoxyanthracene |
|---|---|
| PubChem CID | 87876071 |
| Molecular Formula | C19H18Cl2O |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 1,8-dichloro-9-pentoxyanthracene |
| SMILES | CCCCCOc1c2c(Cl)cccc2cc2cccc(Cl)c12 |
| InChI | InChI=1S/C19H18Cl2O/c1-2-3-4-11-22-19-17-13(7-5-9-15(17)20)12-14-8-6-10-16(21)18(14)19/h5-10,12H,2-4,11H2,1H3 |
| InChIKey | FXGMUWIXYLXPHG-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|