C18H16Cl2O — CID 11723453
9-butoxy-1,5-dichloroanthracene (PubChem CID 11723453) has the molecular formula C18H16Cl2O and a molecular weight of 319.23 g/mol. Its IUPAC name is 9-butoxy-1,5-dichloroanthracene.
| Compound Name | 9-butoxy-1,5-dichloroanthracene |
|---|---|
| PubChem CID | 11723453 |
| Molecular Formula | C18H16Cl2O |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 9-butoxy-1,5-dichloroanthracene |
| SMILES | CCCCOc1c2cccc(Cl)c2cc2cccc(Cl)c12 |
| InChI | InChI=1S/C18H16Cl2O/c1-2-3-10-21-18-13-7-5-8-15(19)14(13)11-12-6-4-9-16(20)17(12)18/h4-9,11H,2-3,10H2,1H3 |
| InChIKey | VYVPCMBBBSCOQI-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|