C30H45ClO5 — CID 23038677
(8-chloro-4-hexoxy-2,3-dipentoxynaphthalen-1-yl) butanoate (PubChem CID 23038677) has the molecular formula C30H45ClO5 and a molecular weight of 521.14 g/mol. Its IUPAC name is (8-chloro-4-hexoxy-2,3-dipentoxynaphthalen-1-yl) butanoate.
| Compound Name | (8-chloro-4-hexoxy-2,3-dipentoxynaphthalen-1-yl) butanoate |
|---|---|
| PubChem CID | 23038677 |
| Molecular Formula | C30H45ClO5 |
| Molecular Weight | 521.14 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | (8-chloro-4-hexoxy-2,3-dipentoxynaphthalen-1-yl) butanoate |
| SMILES | CCCCCCOc1c(OCCCCC)c(OCCCCC)c(OC(=O)CCC)c2c(Cl)cccc12 |
| InChI | InChI=1S/C30H45ClO5/c1-5-9-12-15-22-33-27-23-18-16-19-24(31)26(23)28(36-25(32)17-8-4)30(35-21-14-11-7-3)29(27)34-20-13-10-6-2/h16,18-19H,5-15,17,20-22H2,1-4H3 |
| InChIKey | KNGYKPDSALVGBQ-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.14 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|