About 1-chloronaphthalene;pentane
1-chloronaphthalene;pentane (PubChem CID 19360859) has the molecular formula C15H19Cl
and a molecular weight of 234.77 g/mol. Its IUPAC name is 1-chloronaphthalene;pentane.
Molecular Properties
| Compound Name | 1-chloronaphthalene;pentane |
| PubChem CID | 19360859 |
| Molecular Formula | C15H19Cl |
| Molecular Weight | 234.77 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 1-chloronaphthalene;pentane |
| SMILES | CCCCC.Clc1cccc2ccccc12 |
| InChI | InChI=1S/C10H7Cl.C5H12/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-3-5-4-2/h1-7H;3-5H2,1-2H3 |
| InChIKey | IGAKUOAAGNJNDR-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 234.77 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloronaphthalene;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloronaphthalene;pentane?
The IUPAC name of 1-chloronaphthalene;pentane (CID 19360859) is 1-chloronaphthalene;pentane.
What is the SMILES notation for 1-chloronaphthalene;pentane?
The canonical SMILES for 1-chloronaphthalene;pentane is CCCCC.Clc1cccc2ccccc12.
What is the InChIKey of 1-chloronaphthalene;pentane?
The InChIKey is IGAKUOAAGNJNDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Cl.C5H12/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-3-5-4-2/h1-7H;3-5H2,1-2H3.
What are the key properties of 1-chloronaphthalene;pentane?
1-chloronaphthalene;pentane has a molecular weight of 234.77 g/mol, XLogP of 5.69, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloronaphthalene;pentane is sourced from PubChem (CID 19360859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).