About methoxymethane;naphthalene;pentane
methoxymethane;naphthalene;pentane (PubChem CID 91431163) has the molecular formula C17H26O
and a molecular weight of 246.39 g/mol. Its IUPAC name is methoxymethane;naphthalene;pentane.
Molecular Properties
| Compound Name | methoxymethane;naphthalene;pentane |
| PubChem CID | 91431163 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | methoxymethane;naphthalene;pentane |
| SMILES | CCCCC.COC.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C5H12.C2H6O/c1-2-6-10-8-4-3-7-9(10)5-1;1-3-5-4-2;1-3-2/h1-8H;3-5H2,1-2H3;1-2H3 |
| InChIKey | HYQAJMVNRIWYTH-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methoxymethane;naphthalene;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethane;naphthalene;pentane?
The IUPAC name of methoxymethane;naphthalene;pentane (CID 91431163) is methoxymethane;naphthalene;pentane.
What is the SMILES notation for methoxymethane;naphthalene;pentane?
The canonical SMILES for methoxymethane;naphthalene;pentane is CCCCC.COC.c1ccc2ccccc2c1.
What is the InChIKey of methoxymethane;naphthalene;pentane?
The InChIKey is HYQAJMVNRIWYTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C5H12.C2H6O/c1-2-6-10-8-4-3-7-9(10)5-1;1-3-5-4-2;1-3-2/h1-8H;3-5H2,1-2H3;1-2H3.
What are the key properties of methoxymethane;naphthalene;pentane?
methoxymethane;naphthalene;pentane has a molecular weight of 246.39 g/mol, XLogP of 5.30, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethane;naphthalene;pentane is sourced from PubChem (CID 91431163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).