About 1-chloropentane;perylene
1-chloropentane;perylene (PubChem CID 174651563) has the molecular formula C25H23Cl
and a molecular weight of 358.91 g/mol. Its IUPAC name is 1-chloropentane;perylene.
Molecular Properties
| Compound Name | 1-chloropentane;perylene |
| PubChem CID | 174651563 |
| Molecular Formula | C25H23Cl |
| Molecular Weight | 358.91 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-chloropentane;perylene |
| SMILES | CCCCCCl.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54 |
| InChI | InChI=1S/C20H12.C5H11Cl/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;1-2-3-4-5-6/h1-12H;2-5H2,1H3 |
| InChIKey | KVQPHVCBYZLZNT-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.91 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropentane;perylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropentane;perylene?
The IUPAC name of 1-chloropentane;perylene (CID 174651563) is 1-chloropentane;perylene.
What is the SMILES notation for 1-chloropentane;perylene?
The canonical SMILES for 1-chloropentane;perylene is CCCCCCl.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54.
What is the InChIKey of 1-chloropentane;perylene?
The InChIKey is KVQPHVCBYZLZNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12.C5H11Cl/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;1-2-3-4-5-6/h1-12H;2-5H2,1H3.
What are the key properties of 1-chloropentane;perylene?
1-chloropentane;perylene has a molecular weight of 358.91 g/mol, XLogP of 8.15, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropentane;perylene is sourced from PubChem (CID 174651563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).