C33H33ClO6 — CID 23038252
[4-acetyloxy-7-chloro-2,3-bis(3-methylphenoxy)naphthalen-1-yl] 2,2-dimethylpentanoate (PubChem CID 23038252) has the molecular formula C33H33ClO6 and a molecular weight of 561.07 g/mol. Its IUPAC name is [4-acetyloxy-7-chloro-2,3-bis(3-methylphenoxy)naphthalen-1-yl] 2,2-dimethylpentanoate.
| Compound Name | [4-acetyloxy-7-chloro-2,3-bis(3-methylphenoxy)naphthalen-1-yl] 2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 23038252 |
| Molecular Formula | C33H33ClO6 |
| Molecular Weight | 561.07 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | [4-acetyloxy-7-chloro-2,3-bis(3-methylphenoxy)naphthalen-1-yl] 2,2-dimethylpentanoate |
| SMILES | CCCC(C)(C)C(=O)Oc1c(Oc2cccc(C)c2)c(Oc2cccc(C)c2)c(OC(C)=O)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C33H33ClO6/c1-7-16-33(5,6)32(36)40-29-27-19-23(34)14-15-26(27)28(37-22(4)35)30(38-24-12-8-10-20(2)17-24)31(29)39-25-13-9-11-21(3)18-25/h8-15,17-19H,7,16H2,1-6H3 |
| InChIKey | CWFSZEFXDIEHDT-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.07 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|