C21H22O5 — CID 163406422
(10-methoxycarbonyloxy-2-methyl-1,2,3,4-tetrahydroanthracen-9-yl) 2-methylprop-2-enoate (PubChem CID 163406422) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is (10-methoxycarbonyloxy-2-methyl-1,2,3,4-tetrahydroanthracen-9-yl) 2-methylprop-2-enoate.
| Compound Name | (10-methoxycarbonyloxy-2-methyl-1,2,3,4-tetrahydroanthracen-9-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163406422 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (10-methoxycarbonyloxy-2-methyl-1,2,3,4-tetrahydroanthracen-9-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c2c(c(OC(=O)OC)c3ccccc13)CCC(C)C2 |
| InChI | InChI=1S/C21H22O5/c1-12(2)20(22)25-19-15-8-6-5-7-14(15)18(26-21(23)24-4)16-10-9-13(3)11-17(16)19/h5-8,13H,1,9-11H2,2-4H3 |
| InChIKey | XDPDOAXROOHIBN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|