C19H20O3 — CID 163406859
(10-methoxy-2-methyl-1,2,3,4-tetrahydroanthracen-9-yl) prop-2-enoate (PubChem CID 163406859) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is (10-methoxy-2-methyl-1,2,3,4-tetrahydroanthracen-9-yl) prop-2-enoate.
| Compound Name | (10-methoxy-2-methyl-1,2,3,4-tetrahydroanthracen-9-yl) prop-2-enoate |
|---|---|
| PubChem CID | 163406859 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (10-methoxy-2-methyl-1,2,3,4-tetrahydroanthracen-9-yl) prop-2-enoate |
| SMILES | C=CC(=O)Oc1c2c(c(OC)c3ccccc13)CCC(C)C2 |
| InChI | InChI=1S/C19H20O3/c1-4-17(20)22-19-14-8-6-5-7-13(14)18(21-3)15-10-9-12(2)11-16(15)19/h4-8,12H,1,9-11H2,2-3H3 |
| InChIKey | VZAIRJNJKXMTGU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|