C31H44O4 — CID 153323301
[10-(2-ethylhexanoyloxy)-3-methyl-1,2,3,4-tetrahydroanthracen-9-yl] 2-ethylhexanoate (PubChem CID 153323301) has the molecular formula C31H44O4 and a molecular weight of 480.69 g/mol. Its IUPAC name is [10-(2-ethylhexanoyloxy)-3-methyl-1,2,3,4-tetrahydroanthracen-9-yl] 2-ethylhexanoate.
| Compound Name | [10-(2-ethylhexanoyloxy)-3-methyl-1,2,3,4-tetrahydroanthracen-9-yl] 2-ethylhexanoate |
|---|---|
| PubChem CID | 153323301 |
| Molecular Formula | C31H44O4 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | [10-(2-ethylhexanoyloxy)-3-methyl-1,2,3,4-tetrahydroanthracen-9-yl] 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)Oc1c2c(c(OC(=O)C(CC)CCCC)c3ccccc13)CC(C)CC2 |
| InChI | InChI=1S/C31H44O4/c1-6-10-14-22(8-3)30(32)34-28-24-16-12-13-17-25(24)29(27-20-21(5)18-19-26(27)28)35-31(33)23(9-4)15-11-7-2/h12-13,16-17,21-23H,6-11,14-15,18-20H2,1-5H3 |
| InChIKey | YYLYAYRZNTXVFH-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|