C32H42O4 — CID 135239799
[10-(2-ethylhexanoyloxy)-2,3-dimethylanthracen-9-yl] 2-ethylhexanoate (PubChem CID 135239799) has the molecular formula C32H42O4 and a molecular weight of 490.68 g/mol. Its IUPAC name is [10-(2-ethylhexanoyloxy)-2,3-dimethylanthracen-9-yl] 2-ethylhexanoate.
| Compound Name | [10-(2-ethylhexanoyloxy)-2,3-dimethylanthracen-9-yl] 2-ethylhexanoate |
|---|---|
| PubChem CID | 135239799 |
| Molecular Formula | C32H42O4 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | [10-(2-ethylhexanoyloxy)-2,3-dimethylanthracen-9-yl] 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)Oc1c2ccccc2c(OC(=O)C(CC)CCCC)c2cc(C)c(C)cc12 |
| InChI | InChI=1S/C32H42O4/c1-7-11-15-23(9-3)31(33)35-29-25-17-13-14-18-26(25)30(28-20-22(6)21(5)19-27(28)29)36-32(34)24(10-4)16-12-8-2/h13-14,17-20,23-24H,7-12,15-16H2,1-6H3 |
| InChIKey | ZQNOLHGDKLEZHH-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|