C30H42O4 — CID 153323160
[10-(2-ethylhexanoyloxy)-1,2,3,4-tetrahydroanthracen-9-yl] 2-ethylhexanoate (PubChem CID 153323160) has the molecular formula C30H42O4 and a molecular weight of 466.66 g/mol. Its IUPAC name is [10-(2-ethylhexanoyloxy)-1,2,3,4-tetrahydroanthracen-9-yl] 2-ethylhexanoate.
| Compound Name | [10-(2-ethylhexanoyloxy)-1,2,3,4-tetrahydroanthracen-9-yl] 2-ethylhexanoate |
|---|---|
| PubChem CID | 153323160 |
| Molecular Formula | C30H42O4 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | [10-(2-ethylhexanoyloxy)-1,2,3,4-tetrahydroanthracen-9-yl] 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)Oc1c2c(c(OC(=O)C(CC)CCCC)c3ccccc13)CCCC2 |
| InChI | InChI=1S/C30H42O4/c1-5-9-15-21(7-3)29(31)33-27-23-17-11-13-19-25(23)28(26-20-14-12-18-24(26)27)34-30(32)22(8-4)16-10-6-2/h11,13,17,19,21-22H,5-10,12,14-16,18,20H2,1-4H3 |
| InChIKey | ONSDJRCNVBATMN-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|