C30H32O3 — CID 163406606
[2-(4-methylpent-3-enyl)-10-phenoxy-1,2,3,4-tetrahydroanthracen-9-yl] 2-methylprop-2-enoate (PubChem CID 163406606) has the molecular formula C30H32O3 and a molecular weight of 440.58 g/mol. Its IUPAC name is [2-(4-methylpent-3-enyl)-10-phenoxy-1,2,3,4-tetrahydroanthracen-9-yl] 2-methylprop-2-enoate.
| Compound Name | [2-(4-methylpent-3-enyl)-10-phenoxy-1,2,3,4-tetrahydroanthracen-9-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163406606 |
| Molecular Formula | C30H32O3 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | [2-(4-methylpent-3-enyl)-10-phenoxy-1,2,3,4-tetrahydroanthracen-9-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c2c(c(Oc3ccccc3)c3ccccc13)CCC(CCC=C(C)C)C2 |
| InChI | InChI=1S/C30H32O3/c1-20(2)11-10-12-22-17-18-26-27(19-22)29(33-30(31)21(3)4)25-16-9-8-15-24(25)28(26)32-23-13-6-5-7-14-23/h5-9,11,13-16,22H,3,10,12,17-19H2,1-2,4H3 |
| InChIKey | HWUOMTZWOPKGAA-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|