C26H28O3 — CID 163406469
[10-methoxy-14-(4-methylpent-3-enyl)-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10,13-hexaenyl] 2-methylprop-2-enoate (PubChem CID 163406469) has the molecular formula C26H28O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is [10-methoxy-14-(4-methylpent-3-enyl)-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10,13-hexaenyl] 2-methylprop-2-enoate.
| Compound Name | [10-methoxy-14-(4-methylpent-3-enyl)-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10,13-hexaenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163406469 |
| Molecular Formula | C26H28O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | [10-methoxy-14-(4-methylpent-3-enyl)-3-tetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10,13-hexaenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c2c(c(OC)c3ccccc13)C1C=C(CCC=C(C)C)C2C1 |
| InChI | InChI=1S/C26H28O3/c1-15(2)9-8-10-17-13-18-14-21(17)23-22(18)24(28-5)19-11-6-7-12-20(19)25(23)29-26(27)16(3)4/h6-7,9,11-13,18,21H,3,8,10,14H2,1-2,4-5H3 |
| InChIKey | BORQDLCBWWNXSC-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|