C20H18O6S — CID 19360927
[3-[3-(2-methylprop-2-enoyloxy)phenyl]sulfonylphenyl] 2-methylprop-2-enoate (PubChem CID 19360927) has the molecular formula C20H18O6S and a molecular weight of 386.43 g/mol. Its IUPAC name is [3-[3-(2-methylprop-2-enoyloxy)phenyl]sulfonylphenyl] 2-methylprop-2-enoate.
| Compound Name | [3-[3-(2-methylprop-2-enoyloxy)phenyl]sulfonylphenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 19360927 |
| Molecular Formula | C20H18O6S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | [3-[3-(2-methylprop-2-enoyloxy)phenyl]sulfonylphenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1cccc(S(=O)(=O)c2cccc(OC(=O)C(=C)C)c2)c1 |
| InChI | InChI=1S/C20H18O6S/c1-13(2)19(21)25-15-7-5-9-17(11-15)27(23,24)18-10-6-8-16(12-18)26-20(22)14(3)4/h5-12H,1,3H2,2,4H3 |
| InChIKey | UILAFZOLPMNBBT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|