C22H20O4 — CID 155004792
[3-(2-methylprop-2-enoyloxy)-5-[(E)-2-phenylethenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 155004792) has the molecular formula C22H20O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is [3-(2-methylprop-2-enoyloxy)-5-[(E)-2-phenylethenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [3-(2-methylprop-2-enoyloxy)-5-[(E)-2-phenylethenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155004792 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | [3-(2-methylprop-2-enoyloxy)-5-[(E)-2-phenylethenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1cc(/C=C/c2ccccc2)cc(OC(=O)C(=C)C)c1 |
| InChI | InChI=1S/C22H20O4/c1-15(2)21(23)25-19-12-18(11-10-17-8-6-5-7-9-17)13-20(14-19)26-22(24)16(3)4/h5-14H,1,3H2,2,4H3/b11-10+ |
| InChIKey | OHHCCEFDKFWWJZ-ZHACJKMWSA-N |
| XLogP | 4.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|