C26H24O6 — CID 155004805
[3-[(E)-2-[3,5-bis(2-methylprop-2-enoyloxy)phenyl]ethenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 155004805) has the molecular formula C26H24O6 and a molecular weight of 432.47 g/mol. Its IUPAC name is [3-[(E)-2-[3,5-bis(2-methylprop-2-enoyloxy)phenyl]ethenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [3-[(E)-2-[3,5-bis(2-methylprop-2-enoyloxy)phenyl]ethenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155004805 |
| Molecular Formula | C26H24O6 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | [3-[(E)-2-[3,5-bis(2-methylprop-2-enoyloxy)phenyl]ethenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1cccc(/C=C/c2cc(OC(=O)C(=C)C)cc(OC(=O)C(=C)C)c2)c1 |
| InChI | InChI=1S/C26H24O6/c1-16(2)24(27)30-21-9-7-8-19(12-21)10-11-20-13-22(31-25(28)17(3)4)15-23(14-20)32-26(29)18(5)6/h7-15H,1,3,5H2,2,4,6H3/b11-10+ |
| InChIKey | LAZUBUBBOGABPB-ZHACJKMWSA-N |
| XLogP | 5.30 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|