About phenyl 2-methylprop-2-enoate;styrene
phenyl 2-methylprop-2-enoate;styrene (PubChem CID 22227486) has the molecular formula C18H18O2
and a molecular weight of 266.34 g/mol. Its IUPAC name is phenyl 2-methylprop-2-enoate;styrene.
Molecular Properties
| Compound Name | phenyl 2-methylprop-2-enoate;styrene |
| PubChem CID | 22227486 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | phenyl 2-methylprop-2-enoate;styrene |
| SMILES | C=C(C)C(=O)Oc1ccccc1.C=Cc1ccccc1 |
| InChI | InChI=1S/C10H10O2.C8H8/c1-8(2)10(11)12-9-6-4-3-5-7-9;1-2-8-6-4-3-5-7-8/h3-7H,1H2,2H3;2-7H,1H2 |
| InChIKey | CSZZVSAEGFJSQO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 2-methylprop-2-enoate;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 2-methylprop-2-enoate;styrene?
The IUPAC name of phenyl 2-methylprop-2-enoate;styrene (CID 22227486) is phenyl 2-methylprop-2-enoate;styrene.
What is the SMILES notation for phenyl 2-methylprop-2-enoate;styrene?
The canonical SMILES for phenyl 2-methylprop-2-enoate;styrene is C=C(C)C(=O)Oc1ccccc1.C=Cc1ccccc1.
What is the InChIKey of phenyl 2-methylprop-2-enoate;styrene?
The InChIKey is CSZZVSAEGFJSQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2.C8H8/c1-8(2)10(11)12-9-6-4-3-5-7-9;1-2-8-6-4-3-5-7-8/h3-7H,1H2,2H3;2-7H,1H2.
What are the key properties of phenyl 2-methylprop-2-enoate;styrene?
phenyl 2-methylprop-2-enoate;styrene has a molecular weight of 266.34 g/mol, XLogP of 4.50, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 2-methylprop-2-enoate;styrene is sourced from PubChem (CID 22227486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).