C32H28N2O6S — CID 19366184
2-methyl-N-[3-[3-[3-[3-(2-methylprop-2-enoylamino)phenoxy]phenyl]sulfonylphenoxy]phenyl]prop-2-enamide (PubChem CID 19366184) has the molecular formula C32H28N2O6S and a molecular weight of 568.65 g/mol. Its IUPAC name is 2-methyl-N-[3-[3-[3-[3-(2-methylprop-2-enoylamino)phenoxy]phenyl]sulfonylphenoxy]phenyl]prop-2-enamide.
| Compound Name | 2-methyl-N-[3-[3-[3-[3-(2-methylprop-2-enoylamino)phenoxy]phenyl]sulfonylphenoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 19366184 |
| Molecular Formula | C32H28N2O6S |
| Molecular Weight | 568.65 g/mol |
| Exact Mass | 568.17 |
| IUPAC Name | 2-methyl-N-[3-[3-[3-[3-(2-methylprop-2-enoylamino)phenoxy]phenyl]sulfonylphenoxy]phenyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1cccc(Oc2cccc(S(=O)(=O)c3cccc(Oc4cccc(NC(=O)C(=C)C)c4)c3)c2)c1 |
| InChI | InChI=1S/C32H28N2O6S/c1-21(2)31(35)33-23-9-5-11-25(17-23)39-27-13-7-15-29(19-27)41(37,38)30-16-8-14-28(20-30)40-26-12-6-10-24(18-26)34-32(36)22(3)4/h5-20H,1,3H2,2,4H3,(H,33,35)(H,34,36) |
| InChIKey | UXYUZUPBQAQEFK-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.65 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|