C10H13N2O+ — CID 140585857
[3-(2-methylprop-2-enoylamino)phenyl]azanium (PubChem CID 140585857) has the molecular formula C10H13N2O+ and a molecular weight of 177.23 g/mol. Its IUPAC name is [3-(2-methylprop-2-enoylamino)phenyl]azanium.
| Compound Name | [3-(2-methylprop-2-enoylamino)phenyl]azanium |
|---|---|
| PubChem CID | 140585857 |
| Molecular Formula | C10H13N2O+ |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | [3-(2-methylprop-2-enoylamino)phenyl]azanium |
| SMILES | C=C(C)C(=O)Nc1cccc([NH3+])c1 |
| InChI | InChI=1S/C10H12N2O/c1-7(2)10(13)12-9-5-3-4-8(11)6-9/h3-6H,1,11H2,2H3,(H,12,13)/p+1 |
| InChIKey | LGSCAAAGLNBNPI-UHFFFAOYSA-O |
| XLogP | 1.07 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|