C12H14N2O4 — CID 174584414
methyl 3,4-diamino-2-(2-methylprop-2-enoyloxy)benzoate (PubChem CID 174584414) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is methyl 3,4-diamino-2-(2-methylprop-2-enoyloxy)benzoate.
| Compound Name | methyl 3,4-diamino-2-(2-methylprop-2-enoyloxy)benzoate |
|---|---|
| PubChem CID | 174584414 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | methyl 3,4-diamino-2-(2-methylprop-2-enoyloxy)benzoate |
| SMILES | C=C(C)C(=O)Oc1c(C(=O)OC)ccc(N)c1N |
| InChI | InChI=1S/C12H14N2O4/c1-6(2)11(15)18-10-7(12(16)17-3)4-5-8(13)9(10)14/h4-5H,1,13-14H2,2-3H3 |
| InChIKey | GGZJZPNEIAPKKH-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|