C6H6Na2O8S2 — CID 173398336
CID 173398336 (PubChem CID 173398336) has the molecular formula C6H6Na2O8S2 and a molecular weight of 316.22 g/mol.
| Compound Name | CID 173398336 |
|---|---|
| PubChem CID | 173398336 |
| Molecular Formula | C6H6Na2O8S2 |
| Molecular Weight | 316.22 g/mol |
| Exact Mass | 315.93 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1cc(O)c(S(=O)(=O)O)cc1O.[Na].[Na] |
| InChI | InChI=1S/C6H6O8S2.2Na/c7-3-1-5(15(9,10)11)4(8)2-6(3)16(12,13)14;;/h1-2,7-8H,(H,9,10,11)(H,12,13,14);; |
| InChIKey | ITTBCPWQCACXMB-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.22 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|