C10H8O11S3 — CID 14931165
2,7-dihydroxynaphthalene-1,3,6-trisulfonic acid (PubChem CID 14931165) has the molecular formula C10H8O11S3 and a molecular weight of 400.36 g/mol. Its IUPAC name is 2,7-dihydroxynaphthalene-1,3,6-trisulfonic acid.
| Compound Name | 2,7-dihydroxynaphthalene-1,3,6-trisulfonic acid |
|---|---|
| PubChem CID | 14931165 |
| Molecular Formula | C10H8O11S3 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 399.92 |
| IUPAC Name | 2,7-dihydroxynaphthalene-1,3,6-trisulfonic acid |
| SMILES | O=S(=O)(O)c1cc2cc(S(=O)(=O)O)c(O)c(S(=O)(=O)O)c2cc1O |
| InChI | InChI=1S/C10H8O11S3/c11-6-3-5-4(1-7(6)22(13,14)15)2-8(23(16,17)18)9(12)10(5)24(19,20)21/h1-3,11-12H,(H,13,14,15)(H,16,17,18)(H,19,20,21) |
| InChIKey | SPNNHHOTLPMADJ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 203.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|