2,7-dihydroxynaphthalene-1,3,6-trisulfonic acid

C10H8O11S3 — CID 14931165

IUPAC2,7-dihydroxynaphthalene-1,3,6-trisulfonic acid
SMILESO=S(=O)(O)c1cc2cc(S(=O)(=O)O)c(O)c(S(=O)(=O)O)c2cc1O
InChIInChI=1S/C10H8O11S3/c11-6-3-5-4(1-7(6)22(13,14)15)2-8(23(16,17)18)9(12)10(5)24(19,20)21/h1-3,11-12H,(H,13,14,15)(H,16,17,18)(H,19,20,21)
InChIKeySPNNHHOTLPMADJ-UHFFFAOYSA-N
MW400.36 g/mol
LogP-0.01
Rot. Bonds3

About 2,7-dihydroxynaphthalene-1,3,6-trisulfonic acid

2,7-dihydroxynaphthalene-1,3,6-trisulfonic acid (PubChem CID 14931165) has the molecular formula C10H8O11S3 and a molecular weight of 400.36 g/mol. Its IUPAC name is 2,7-dihydroxynaphthalene-1,3,6-trisulfonic acid.

Molecular Properties

Compound Name2,7-dihydroxynaphthalene-1,3,6-trisulfonic acid
PubChem CID14931165
Molecular FormulaC10H8O11S3
Molecular Weight400.36 g/mol
Exact Mass399.92
IUPAC Name2,7-dihydroxynaphthalene-1,3,6-trisulfonic acid
SMILESO=S(=O)(O)c1cc2cc(S(=O)(=O)O)c(O)c(S(=O)(=O)O)c2cc1O
InChIInChI=1S/C10H8O11S3/c11-6-3-5-4(1-7(6)22(13,14)15)2-8(23(16,17)18)9(12)10(5)24(19,20)21/h1-3,11-12H,(H,13,14,15)(H,16,17,18)(H,19,20,21)
InChIKeySPNNHHOTLPMADJ-UHFFFAOYSA-N
XLogP-0.01
TPSA203.57 Ų
H-Bond Donors5
H-Bond Acceptors8
Rotatable Bonds3
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500400.36
LogP ≤ 5-0.01
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2,7-dihydroxynaphthalene-1,3,6-trisulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,7-dihydroxynaphthalene-1,3,6-trisulfonic acid?
The IUPAC name of 2,7-dihydroxynaphthalene-1,3,6-trisulfonic acid (CID 14931165) is 2,7-dihydroxynaphthalene-1,3,6-trisulfonic acid.
What is the SMILES notation for 2,7-dihydroxynaphthalene-1,3,6-trisulfonic acid?
The canonical SMILES for 2,7-dihydroxynaphthalene-1,3,6-trisulfonic acid is O=S(=O)(O)c1cc2cc(S(=O)(=O)O)c(O)c(S(=O)(=O)O)c2cc1O.
What is the InChIKey of 2,7-dihydroxynaphthalene-1,3,6-trisulfonic acid?
The InChIKey is SPNNHHOTLPMADJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O11S3/c11-6-3-5-4(1-7(6)22(13,14)15)2-8(23(16,17)18)9(12)10(5)24(19,20)21/h1-3,11-12H,(H,13,14,15)(H,16,17,18)(H,19,20,21).
What are the key properties of 2,7-dihydroxynaphthalene-1,3,6-trisulfonic acid?
2,7-dihydroxynaphthalene-1,3,6-trisulfonic acid has a molecular weight of 400.36 g/mol, XLogP of -0.01, 3 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dihydroxynaphthalene-1,3,6-trisulfonic acid is sourced from PubChem (CID 14931165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).