2,4-dihydroxybenzene-1,3,5-trisulfonic acid

C6H6O11S3 — CID 14197006

IUPAC2,4-dihydroxybenzene-1,3,5-trisulfonic acid
SMILESO=S(=O)(O)c1cc(S(=O)(=O)O)c(O)c(S(=O)(=O)O)c1O
InChIInChI=1S/C6H6O11S3/c7-4-2(18(9,10)11)1-3(19(12,13)14)5(8)6(4)20(15,16)17/h1,7-8H,(H,9,10,11)(H,12,13,14)(H,15,16,17)
InChIKeyWSFCHCRTBQKDOR-UHFFFAOYSA-N
MW350.30 g/mol
LogP-1.16
Rot. Bonds3

About 2,4-dihydroxybenzene-1,3,5-trisulfonic acid

2,4-dihydroxybenzene-1,3,5-trisulfonic acid (PubChem CID 14197006) has the molecular formula C6H6O11S3 and a molecular weight of 350.30 g/mol. Its IUPAC name is 2,4-dihydroxybenzene-1,3,5-trisulfonic acid.

Molecular Properties

Compound Name2,4-dihydroxybenzene-1,3,5-trisulfonic acid
PubChem CID14197006
Molecular FormulaC6H6O11S3
Molecular Weight350.30 g/mol
Exact Mass349.91
IUPAC Name2,4-dihydroxybenzene-1,3,5-trisulfonic acid
SMILESO=S(=O)(O)c1cc(S(=O)(=O)O)c(O)c(S(=O)(=O)O)c1O
InChIInChI=1S/C6H6O11S3/c7-4-2(18(9,10)11)1-3(19(12,13)14)5(8)6(4)20(15,16)17/h1,7-8H,(H,9,10,11)(H,12,13,14)(H,15,16,17)
InChIKeyWSFCHCRTBQKDOR-UHFFFAOYSA-N
XLogP-1.16
TPSA203.57 Ų
H-Bond Donors5
H-Bond Acceptors8
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500350.30
LogP ≤ 5-1.16
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2,4-dihydroxybenzene-1,3,5-trisulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dihydroxybenzene-1,3,5-trisulfonic acid?
The IUPAC name of 2,4-dihydroxybenzene-1,3,5-trisulfonic acid (CID 14197006) is 2,4-dihydroxybenzene-1,3,5-trisulfonic acid.
What is the SMILES notation for 2,4-dihydroxybenzene-1,3,5-trisulfonic acid?
The canonical SMILES for 2,4-dihydroxybenzene-1,3,5-trisulfonic acid is O=S(=O)(O)c1cc(S(=O)(=O)O)c(O)c(S(=O)(=O)O)c1O.
What is the InChIKey of 2,4-dihydroxybenzene-1,3,5-trisulfonic acid?
The InChIKey is WSFCHCRTBQKDOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O11S3/c7-4-2(18(9,10)11)1-3(19(12,13)14)5(8)6(4)20(15,16)17/h1,7-8H,(H,9,10,11)(H,12,13,14)(H,15,16,17).
What are the key properties of 2,4-dihydroxybenzene-1,3,5-trisulfonic acid?
2,4-dihydroxybenzene-1,3,5-trisulfonic acid has a molecular weight of 350.30 g/mol, XLogP of -1.16, 3 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dihydroxybenzene-1,3,5-trisulfonic acid is sourced from PubChem (CID 14197006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).