C20H16O20S6 — CID 88606233
2-hydroxynaphthalene-1,3,6-trisulfonic acid;7-hydroxynaphthalene-1,3,6-trisulfonic acid (PubChem CID 88606233) has the molecular formula C20H16O20S6 and a molecular weight of 768.73 g/mol. Its IUPAC name is 2-hydroxynaphthalene-1,3,6-trisulfonic acid;7-hydroxynaphthalene-1,3,6-trisulfonic acid.
| Compound Name | 2-hydroxynaphthalene-1,3,6-trisulfonic acid;7-hydroxynaphthalene-1,3,6-trisulfonic acid |
|---|---|
| PubChem CID | 88606233 |
| Molecular Formula | C20H16O20S6 |
| Molecular Weight | 768.73 g/mol |
| Exact Mass | 767.86 |
| IUPAC Name | 2-hydroxynaphthalene-1,3,6-trisulfonic acid;7-hydroxynaphthalene-1,3,6-trisulfonic acid |
| SMILES | O=S(=O)(O)c1cc(S(=O)(=O)O)c2cc(O)c(S(=O)(=O)O)cc2c1.O=S(=O)(O)c1ccc2c(S(=O)(=O)O)c(O)c(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/2C10H8O10S3/c11-8-4-7-5(2-10(8)23(18,19)20)1-6(21(12,13)14)3-9(7)22(15,16)17;11-9-8(22(15,16)17)4-5-3-6(21(12,13)14)1-2-7(5)10(9)23(18,19)20/h2*1-4,11H,(H,12,13,14)(H,15,16,17)(H,18,19,20) |
| InChIKey | KRGDNYHYXSTZJO-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 366.68 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.73 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|