C10H8O8S2 — CID 6365319
1,3-dihydroxynaphthalene-2,6-disulfonic acid (PubChem CID 6365319) has the molecular formula C10H8O8S2 and a molecular weight of 320.30 g/mol. Its IUPAC name is 1,3-dihydroxynaphthalene-2,6-disulfonic acid.
| Compound Name | 1,3-dihydroxynaphthalene-2,6-disulfonic acid |
|---|---|
| PubChem CID | 6365319 |
| Molecular Formula | C10H8O8S2 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | 1,3-dihydroxynaphthalene-2,6-disulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2c(O)c(S(=O)(=O)O)c(O)cc2c1 |
| InChI | InChI=1S/C10H8O8S2/c11-8-4-5-3-6(19(13,14)15)1-2-7(5)9(12)10(8)20(16,17)18/h1-4,11-12H,(H,13,14,15)(H,16,17,18) |
| InChIKey | UXRNOJGNQVHLDX-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|