C10H9NO9S2 — CID 155168760
3-hydroxy-4-nitrosonaphthalene-2,7-disulfonic acid;hydrate (PubChem CID 155168760) has the molecular formula C10H9NO9S2 and a molecular weight of 351.31 g/mol. Its IUPAC name is 3-hydroxy-4-nitrosonaphthalene-2,7-disulfonic acid;hydrate.
| Compound Name | 3-hydroxy-4-nitrosonaphthalene-2,7-disulfonic acid;hydrate |
|---|---|
| PubChem CID | 155168760 |
| Molecular Formula | C10H9NO9S2 |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | 3-hydroxy-4-nitrosonaphthalene-2,7-disulfonic acid;hydrate |
| SMILES | O.O=Nc1c(O)c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)ccc12 |
| InChI | InChI=1S/C10H7NO8S2.H2O/c12-10-8(21(17,18)19)4-5-3-6(20(14,15)16)1-2-7(5)9(10)11-13;/h1-4,12H,(H,14,15,16)(H,17,18,19);1H2 |
| InChIKey | LYDCMWAHWXNYMH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 189.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|