C11H10O7S2 — CID 20736921
3-hydroxy-4-methylnaphthalene-2,7-disulfonic acid (PubChem CID 20736921) has the molecular formula C11H10O7S2 and a molecular weight of 318.33 g/mol. Its IUPAC name is 3-hydroxy-4-methylnaphthalene-2,7-disulfonic acid.
| Compound Name | 3-hydroxy-4-methylnaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 20736921 |
| Molecular Formula | C11H10O7S2 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 3-hydroxy-4-methylnaphthalene-2,7-disulfonic acid |
| SMILES | Cc1c(O)c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)ccc12 |
| InChI | InChI=1S/C11H10O7S2/c1-6-9-3-2-8(19(13,14)15)4-7(9)5-10(11(6)12)20(16,17)18/h2-5,12H,1H3,(H,13,14,15)(H,16,17,18) |
| InChIKey | IJVZUYLQVBLDGA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|