C20H14O10S3 — CID 101038926
3-hydroxy-4-(4-sulfonaphthalen-1-yl)naphthalene-2,7-disulfonic acid (PubChem CID 101038926) has the molecular formula C20H14O10S3 and a molecular weight of 510.52 g/mol. Its IUPAC name is 3-hydroxy-4-(4-sulfonaphthalen-1-yl)naphthalene-2,7-disulfonic acid.
| Compound Name | 3-hydroxy-4-(4-sulfonaphthalen-1-yl)naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 101038926 |
| Molecular Formula | C20H14O10S3 |
| Molecular Weight | 510.52 g/mol |
| Exact Mass | 509.97 |
| IUPAC Name | 3-hydroxy-4-(4-sulfonaphthalen-1-yl)naphthalene-2,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2c(-c3ccc(S(=O)(=O)O)c4ccccc34)c(O)c(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C20H14O10S3/c21-20-18(33(28,29)30)10-11-9-12(31(22,23)24)5-6-13(11)19(20)16-7-8-17(32(25,26)27)15-4-2-1-3-14(15)16/h1-10,21H,(H,22,23,24)(H,25,26,27)(H,28,29,30) |
| InChIKey | GMMTZTYTIZPZLI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 183.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|