C10H9KO8S2 — CID 173070046
potassium;6,7-dihydroxynaphthalene-2,3-disulfonic acid;hydride (PubChem CID 173070046) has the molecular formula C10H9KO8S2 and a molecular weight of 360.41 g/mol. Its IUPAC name is potassium;6,7-dihydroxynaphthalene-2,3-disulfonic acid;hydride.
| Compound Name | potassium;6,7-dihydroxynaphthalene-2,3-disulfonic acid;hydride |
|---|---|
| PubChem CID | 173070046 |
| Molecular Formula | C10H9KO8S2 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 359.94 |
| IUPAC Name | potassium;6,7-dihydroxynaphthalene-2,3-disulfonic acid;hydride |
| SMILES | O=S(=O)(O)c1cc2cc(O)c(O)cc2cc1S(=O)(=O)O.[H-].[K+] |
| InChI | InChI=1S/C10H8O8S2.K.H/c11-7-1-5-3-9(19(13,14)15)10(20(16,17)18)4-6(5)2-8(7)12;;/h1-4,11-12H,(H,13,14,15)(H,16,17,18);;/q;+1;-1 |
| InChIKey | CULANOZNBOXOIN-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|