C10H6Cl2O8S2 — CID 3791964
3,6-dichloro-4,5-dihydroxynaphthalene-2,7-disulfonic acid (PubChem CID 3791964) has the molecular formula C10H6Cl2O8S2 and a molecular weight of 389.19 g/mol. Its IUPAC name is 3,6-dichloro-4,5-dihydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 3,6-dichloro-4,5-dihydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 3791964 |
| Molecular Formula | C10H6Cl2O8S2 |
| Molecular Weight | 389.19 g/mol |
| Exact Mass | 387.89 |
| IUPAC Name | 3,6-dichloro-4,5-dihydroxynaphthalene-2,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1cc2cc(S(=O)(=O)O)c(Cl)c(O)c2c(O)c1Cl |
| InChI | InChI=1S/C10H6Cl2O8S2/c11-7-4(21(15,16)17)1-3-2-5(22(18,19)20)8(12)10(14)6(3)9(7)13/h1-2,13-14H,(H,15,16,17)(H,18,19,20) |
| InChIKey | MUVMOZAAOKBDPR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.19 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|