C10H11N3O7S2 — CID 71374363
3,4,6-triamino-5-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 71374363) has the molecular formula C10H11N3O7S2 and a molecular weight of 349.35 g/mol. Its IUPAC name is 3,4,6-triamino-5-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 3,4,6-triamino-5-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 71374363 |
| Molecular Formula | C10H11N3O7S2 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 3,4,6-triamino-5-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | Nc1c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(N)c(O)c2c1N |
| InChI | InChI=1S/C10H11N3O7S2/c11-7-4(21(15,16)17)1-3-2-5(22(18,19)20)8(12)10(14)6(3)9(7)13/h1-2,14H,11-13H2,(H,15,16,17)(H,18,19,20) |
| InChIKey | WXJCYHAUDYBZMO-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 207.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|