C10H8ClNO7S2 — CID 143063605
3-amino-6-chloro-4-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 143063605) has the molecular formula C10H8ClNO7S2 and a molecular weight of 353.76 g/mol. Its IUPAC name is 3-amino-6-chloro-4-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 3-amino-6-chloro-4-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 143063605 |
| Molecular Formula | C10H8ClNO7S2 |
| Molecular Weight | 353.76 g/mol |
| Exact Mass | 352.94 |
| IUPAC Name | 3-amino-6-chloro-4-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | Nc1c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(Cl)cc2c1O |
| InChI | InChI=1S/C10H8ClNO7S2/c11-6-3-5-4(1-7(6)20(14,15)16)2-8(21(17,18)19)9(12)10(5)13/h1-3,13H,12H2,(H,14,15,16)(H,17,18,19) |
| InChIKey | GYQKMHGERUQTOS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 154.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.76 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|