C24H24N6O12S3 — CID 145275957
4-aminobenzenesulfonic acid;3,6-diamino-4-hydroxynaphthalene-2,7-disulfonic acid;4,7-diaminoisoindole-1,3-dione (PubChem CID 145275957) has the molecular formula C24H24N6O12S3 and a molecular weight of 684.69 g/mol. Its IUPAC name is 4-aminobenzenesulfonic acid;3,6-diamino-4-hydroxynaphthalene-2,7-disulfonic acid;4,7-diaminoisoindole-1,3-dione.
| Compound Name | 4-aminobenzenesulfonic acid;3,6-diamino-4-hydroxynaphthalene-2,7-disulfonic acid;4,7-diaminoisoindole-1,3-dione |
|---|---|
| PubChem CID | 145275957 |
| Molecular Formula | C24H24N6O12S3 |
| Molecular Weight | 684.69 g/mol |
| Exact Mass | 684.06 |
| IUPAC Name | 4-aminobenzenesulfonic acid;3,6-diamino-4-hydroxynaphthalene-2,7-disulfonic acid;4,7-diaminoisoindole-1,3-dione |
| SMILES | Nc1cc2c(O)c(N)c(S(=O)(=O)O)cc2cc1S(=O)(=O)O.Nc1ccc(N)c2c1C(=O)NC2=O.Nc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C10H10N2O7S2.C8H7N3O2.C6H7NO3S/c11-6-3-5-4(1-7(6)20(14,15)16)2-8(21(17,18)19)9(12)10(5)13;9-3-1-2-4(10)6-5(3)7(12)11-8(6)13;7-5-1-3-6(4-2-5)11(8,9)10/h1-3,13H,11-12H2,(H,14,15,16)(H,17,18,19);1-2H,9-10H2,(H,11,12,13);1-4H,7H2,(H,8,9,10) |
| InChIKey | JMMXPHQRRNOLHB-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 359.61 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.69 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|