C12H9Cl3N4O7S3 — CID 143250852
4-amino-2,1,3-benzothiadiazole-5,7-disulfonic acid;4-amino-2,3,6-trichlorophenol (PubChem CID 143250852) has the molecular formula C12H9Cl3N4O7S3 and a molecular weight of 523.79 g/mol. Its IUPAC name is 4-amino-2,1,3-benzothiadiazole-5,7-disulfonic acid;4-amino-2,3,6-trichlorophenol.
| Compound Name | 4-amino-2,1,3-benzothiadiazole-5,7-disulfonic acid;4-amino-2,3,6-trichlorophenol |
|---|---|
| PubChem CID | 143250852 |
| Molecular Formula | C12H9Cl3N4O7S3 |
| Molecular Weight | 523.79 g/mol |
| Exact Mass | 521.87 |
| IUPAC Name | 4-amino-2,1,3-benzothiadiazole-5,7-disulfonic acid;4-amino-2,3,6-trichlorophenol |
| SMILES | Nc1c(S(=O)(=O)O)cc(S(=O)(=O)O)c2nsnc12.Nc1cc(Cl)c(O)c(Cl)c1Cl |
| InChI | InChI=1S/C6H4Cl3NO.C6H5N3O6S3/c7-2-1-3(10)4(8)5(9)6(2)11;7-4-2(17(10,11)12)1-3(18(13,14)15)5-6(4)9-16-8-5/h1,11H,10H2;1H,7H2,(H,10,11,12)(H,13,14,15) |
| InChIKey | UDDDTWQMPOPAQE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 206.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.79 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|