C13H15NO4S — CID 22942497
4-amino-5-hydroxy-3,6,7-trimethylnaphthalene-2-sulfonic acid (PubChem CID 22942497) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is 4-amino-5-hydroxy-3,6,7-trimethylnaphthalene-2-sulfonic acid.
| Compound Name | 4-amino-5-hydroxy-3,6,7-trimethylnaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 22942497 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 4-amino-5-hydroxy-3,6,7-trimethylnaphthalene-2-sulfonic acid |
| SMILES | Cc1cc2cc(S(=O)(=O)O)c(C)c(N)c2c(O)c1C |
| InChI | InChI=1S/C13H15NO4S/c1-6-4-9-5-10(19(16,17)18)8(3)12(14)11(9)13(15)7(6)2/h4-5,15H,14H2,1-3H3,(H,16,17,18) |
| InChIKey | RQUALKDYYVRJMO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|