C12H13N5O4S — CID 135987201
5-amino-3-diazenyl-4-hydroxy-7-methyl-6-(methyldiazenyl)naphthalene-2-sulfonic acid (PubChem CID 135987201) has the molecular formula C12H13N5O4S and a molecular weight of 323.33 g/mol. Its IUPAC name is 5-amino-3-diazenyl-4-hydroxy-7-methyl-6-(methyldiazenyl)naphthalene-2-sulfonic acid.
| Compound Name | 5-amino-3-diazenyl-4-hydroxy-7-methyl-6-(methyldiazenyl)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135987201 |
| Molecular Formula | C12H13N5O4S |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 5-amino-3-diazenyl-4-hydroxy-7-methyl-6-(methyldiazenyl)naphthalene-2-sulfonic acid |
| SMILES | [H]/N=N/c1c(S(=O)(=O)O)cc2cc(C)c(/N=N/C)c(N)c2c1O |
| InChI | InChI=1S/C12H13N5O4S/c1-5-3-6-4-7(22(19,20)21)11(16-14)12(18)8(6)9(13)10(5)17-15-2/h3-4,14,18H,13H2,1-2H3,(H,19,20,21)/b16-14+,17-15+ |
| InChIKey | TWMSBGMFTDXXLH-YXLFCKQPSA-N |
| XLogP | 3.06 |
| TPSA | 161.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|