C12H13N3O7S2 — CID 136621094
4-amino-5-hydroxy-3-methyl-6-(methyldiazenyl)naphthalene-1,7-disulfonic acid (PubChem CID 136621094) has the molecular formula C12H13N3O7S2 and a molecular weight of 375.38 g/mol. Its IUPAC name is 4-amino-5-hydroxy-3-methyl-6-(methyldiazenyl)naphthalene-1,7-disulfonic acid.
| Compound Name | 4-amino-5-hydroxy-3-methyl-6-(methyldiazenyl)naphthalene-1,7-disulfonic acid |
|---|---|
| PubChem CID | 136621094 |
| Molecular Formula | C12H13N3O7S2 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | 4-amino-5-hydroxy-3-methyl-6-(methyldiazenyl)naphthalene-1,7-disulfonic acid |
| SMILES | C/N=N/c1c(S(=O)(=O)O)cc2c(S(=O)(=O)O)cc(C)c(N)c2c1O |
| InChI | InChI=1S/C12H13N3O7S2/c1-5-3-7(23(17,18)19)6-4-8(24(20,21)22)11(15-14-2)12(16)9(6)10(5)13/h3-4,16H,13H2,1-2H3,(H,17,18,19)(H,20,21,22)/b15-14+ |
| InChIKey | ODOQZXWTGMXCBO-CCEZHUSRSA-N |
| XLogP | 1.64 |
| TPSA | 179.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|