C12H12O5S2 — CID 163759668
4,5-dihydroxy-3,6-dimethyl-7-sulfanylnaphthalene-1-sulfonic acid (PubChem CID 163759668) has the molecular formula C12H12O5S2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 4,5-dihydroxy-3,6-dimethyl-7-sulfanylnaphthalene-1-sulfonic acid.
| Compound Name | 4,5-dihydroxy-3,6-dimethyl-7-sulfanylnaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 163759668 |
| Molecular Formula | C12H12O5S2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 4,5-dihydroxy-3,6-dimethyl-7-sulfanylnaphthalene-1-sulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)c2cc(S)c(C)c(O)c2c1O |
| InChI | InChI=1S/C12H12O5S2/c1-5-3-9(19(15,16)17)7-4-8(18)6(2)12(14)10(7)11(5)13/h3-4,13-14,18H,1-2H3,(H,15,16,17) |
| InChIKey | LXCJDYVYDQRHFL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|