C12H13NO7S2 — CID 154524662
5-hydroxy-6-methyl-4-(methylamino)naphthalene-1,7-disulfonic acid (PubChem CID 154524662) has the molecular formula C12H13NO7S2 and a molecular weight of 347.37 g/mol. Its IUPAC name is 5-hydroxy-6-methyl-4-(methylamino)naphthalene-1,7-disulfonic acid.
| Compound Name | 5-hydroxy-6-methyl-4-(methylamino)naphthalene-1,7-disulfonic acid |
|---|---|
| PubChem CID | 154524662 |
| Molecular Formula | C12H13NO7S2 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 5-hydroxy-6-methyl-4-(methylamino)naphthalene-1,7-disulfonic acid |
| SMILES | CNc1ccc(S(=O)(=O)O)c2cc(S(=O)(=O)O)c(C)c(O)c12 |
| InChI | InChI=1S/C12H13NO7S2/c1-6-10(22(18,19)20)5-7-9(21(15,16)17)4-3-8(13-2)11(7)12(6)14/h3-5,13-14H,1-2H3,(H,15,16,17)(H,18,19,20) |
| InChIKey | JSGGDXGQROGSTE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|