C11H15NO3S — CID 142919187
4-(methylamino)-5,6,7,8-tetrahydronaphthalene-1-sulfonic acid (PubChem CID 142919187) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is 4-(methylamino)-5,6,7,8-tetrahydronaphthalene-1-sulfonic acid.
| Compound Name | 4-(methylamino)-5,6,7,8-tetrahydronaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 142919187 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 4-(methylamino)-5,6,7,8-tetrahydronaphthalene-1-sulfonic acid |
| SMILES | CNc1ccc(S(=O)(=O)O)c2c1CCCC2 |
| InChI | InChI=1S/C11H15NO3S/c1-12-10-6-7-11(16(13,14)15)9-5-3-2-4-8(9)10/h6-7,12H,2-5H2,1H3,(H,13,14,15) |
| InChIKey | XVNFZSHKAHNOBA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|