C12H14NO4S- — CID 177277118
4-acetamido-5,6,7,8-tetrahydronaphthalene-1-sulfonate (PubChem CID 177277118) has the molecular formula C12H14NO4S- and a molecular weight of 268.31 g/mol. Its IUPAC name is 4-acetamido-5,6,7,8-tetrahydronaphthalene-1-sulfonate.
| Compound Name | 4-acetamido-5,6,7,8-tetrahydronaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 177277118 |
| Molecular Formula | C12H14NO4S- |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 4-acetamido-5,6,7,8-tetrahydronaphthalene-1-sulfonate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)[O-])c2c1CCCC2 |
| InChI | InChI=1S/C12H15NO4S/c1-8(14)13-11-6-7-12(18(15,16)17)10-5-3-2-4-9(10)11/h6-7H,2-5H2,1H3,(H,13,14)(H,15,16,17)/p-1 |
| InChIKey | DAXVFBRHIQVSSK-UHFFFAOYSA-M |
| XLogP | 1.43 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|