C19H20N2O5S — CID 54449093
3-(3,4-dihydroxyphenyl)-N-(4-sulfamoyl-5,6,7,8-tetrahydronaphthalen-1-yl)prop-2-enamide (PubChem CID 54449093) has the molecular formula C19H20N2O5S and a molecular weight of 388.40 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-N-(4-sulfamoyl-5,6,7,8-tetrahydronaphthalen-1-yl)prop-2-enamide.
| Compound Name | 3-(3,4-dihydroxyphenyl)-N-(4-sulfamoyl-5,6,7,8-tetrahydronaphthalen-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 54449093 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-N-(4-sulfamoyl-5,6,7,8-tetrahydronaphthalen-1-yl)prop-2-enamide |
| SMILES | C1CCC2=C(C=CC(=C2C1)NC(=O)C=CC3=CC(=C(C=C3)O)O)S(=O)(=O)N |
| InChI | InChI=1S/C19H20N2O5S/c20-27(25,26)18-9-7-15(13-3-1-2-4-14(13)18)21-19(24)10-6-12-5-8-16(22)17(23)11-12/h5-11,22-23H,1-4H2,(H,21,24)(H2,20,25,26) |
| InChIKey | WTQXDDMDSYLTKQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | 660 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|